C15H17FN2O3 — CID 51105577
(E)-N-(4-fluorophenyl)-4-(2-methylmorpholin-4-yl)-4-oxobut-2-enamide (PubChem CID 51105577) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is (E)-N-(4-fluorophenyl)-4-(2-methylmorpholin-4-yl)-4-oxobut-2-enamide.
| Compound Name | (E)-N-(4-fluorophenyl)-4-(2-methylmorpholin-4-yl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 51105577 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (E)-N-(4-fluorophenyl)-4-(2-methylmorpholin-4-yl)-4-oxobut-2-enamide |
| SMILES | CC1CN(C(=O)/C=C/C(=O)Nc2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C15H17FN2O3/c1-11-10-18(8-9-21-11)15(20)7-6-14(19)17-13-4-2-12(16)3-5-13/h2-7,11H,8-10H2,1H3,(H,17,19)/b7-6+ |
| InChIKey | JFSBRBMAOYYJCJ-VOTSOKGWSA-N |
| XLogP | 1.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|