C22H25FN2O3 — CID 110620048
3-(4-fluorophenyl)-N-[4-(2-methylmorpholine-4-carbonyl)phenyl]butanamide (PubChem CID 110620048) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[4-(2-methylmorpholine-4-carbonyl)phenyl]butanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[4-(2-methylmorpholine-4-carbonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 110620048 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[4-(2-methylmorpholine-4-carbonyl)phenyl]butanamide |
| SMILES | CC1CN(C(=O)c2ccc(NC(=O)CC(C)c3ccc(F)cc3)cc2)CCO1 |
| InChI | InChI=1S/C22H25FN2O3/c1-15(17-3-7-19(23)8-4-17)13-21(26)24-20-9-5-18(6-10-20)22(27)25-11-12-28-16(2)14-25/h3-10,15-16H,11-14H2,1-2H3,(H,24,26) |
| InChIKey | RABLBHHGBYUWKN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |