C17H24N2O3 — CID 110352683
3-methyl-N-[4-(2-methylmorpholine-4-carbonyl)phenyl]butanamide (PubChem CID 110352683) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-methyl-N-[4-(2-methylmorpholine-4-carbonyl)phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-(2-methylmorpholine-4-carbonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 110352683 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-methyl-N-[4-(2-methylmorpholine-4-carbonyl)phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)N2CCOC(C)C2)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(2)10-16(20)18-15-6-4-14(5-7-15)17(21)19-8-9-22-13(3)11-19/h4-7,12-13H,8-11H2,1-3H3,(H,18,20) |
| InChIKey | XPKXXGCAOZXWCC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |