C14H18BrN3O — CID 110011576
2-[4-[1-(4-bromo-3-methylphenyl)ethylamino]pyrazol-1-yl]ethanol (PubChem CID 110011576) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 2-[4-[1-(4-bromo-3-methylphenyl)ethylamino]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[1-(4-bromo-3-methylphenyl)ethylamino]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 110011576 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[4-[1-(4-bromo-3-methylphenyl)ethylamino]pyrazol-1-yl]ethanol |
| SMILES | Cc1cc(C(C)Nc2cnn(CCO)c2)ccc1Br |
| InChI | InChI=1S/C14H18BrN3O/c1-10-7-12(3-4-14(10)15)11(2)17-13-8-16-18(9-13)5-6-19/h3-4,7-9,11,17,19H,5-6H2,1-2H3 |
| InChIKey | NIDHSUKWWPEERT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |