C19H22N4O2 — CID 110017473
N-(2-hydroxyethyl)-2-[4-(1-naphthalen-2-ylethylamino)pyrazol-1-yl]acetamide (PubChem CID 110017473) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[4-(1-naphthalen-2-ylethylamino)pyrazol-1-yl]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[4-(1-naphthalen-2-ylethylamino)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 110017473 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[4-(1-naphthalen-2-ylethylamino)pyrazol-1-yl]acetamide |
| SMILES | CC(Nc1cnn(CC(=O)NCCO)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H22N4O2/c1-14(16-7-6-15-4-2-3-5-17(15)10-16)22-18-11-21-23(12-18)13-19(25)20-8-9-24/h2-7,10-12,14,22,24H,8-9,13H2,1H3,(H,20,25) |
| InChIKey | MVXWTYCNJGPSKT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |