C14H18FN5O2 — CID 110017430
2-[4-[1-(5-fluoro-2-pyridinyl)ethylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 110017430) has the molecular formula C14H18FN5O2 and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-[4-[1-(5-fluoro-2-pyridinyl)ethylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[4-[1-(5-fluoro-2-pyridinyl)ethylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 110017430 |
| Molecular Formula | C14H18FN5O2 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[4-[1-(5-fluoro-2-pyridinyl)ethylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC(Nc1cnn(CC(=O)NCCO)c1)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H18FN5O2/c1-10(13-3-2-11(15)6-17-13)19-12-7-18-20(8-12)9-14(22)16-4-5-21/h2-3,6-8,10,19,21H,4-5,9H2,1H3,(H,16,22) |
| InChIKey | FXZXGBKCOWQXLX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |