C17H23FN4O2 — CID 110017479
2-[4-[4-(2-fluorophenyl)butan-2-ylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 110017479) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[4-[4-(2-fluorophenyl)butan-2-ylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[4-[4-(2-fluorophenyl)butan-2-ylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 110017479 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[4-[4-(2-fluorophenyl)butan-2-ylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC(CCc1ccccc1F)Nc1cnn(CC(=O)NCCO)c1 |
| InChI | InChI=1S/C17H23FN4O2/c1-13(6-7-14-4-2-3-5-16(14)18)21-15-10-20-22(11-15)12-17(24)19-8-9-23/h2-5,10-11,13,21,23H,6-9,12H2,1H3,(H,19,24) |
| InChIKey | IHKWUENPKDWJFV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |