C16H21FN4O2 — CID 110017463
2-[4-[1-(4-fluorophenyl)propan-2-ylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 110017463) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[4-[1-(4-fluorophenyl)propan-2-ylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[4-[1-(4-fluorophenyl)propan-2-ylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 110017463 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[4-[1-(4-fluorophenyl)propan-2-ylamino]pyrazol-1-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC(Cc1ccc(F)cc1)Nc1cnn(CC(=O)NCCO)c1 |
| InChI | InChI=1S/C16H21FN4O2/c1-12(8-13-2-4-14(17)5-3-13)20-15-9-19-21(10-15)11-16(23)18-6-7-22/h2-5,9-10,12,20,22H,6-8,11H2,1H3,(H,18,23) |
| InChIKey | SZKDCLYGXHGUAW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |