C13H14F2N4O — CID 43695171
2-[4-[1-(3,4-difluorophenyl)ethylamino]pyrazol-1-yl]acetamide (PubChem CID 43695171) has the molecular formula C13H14F2N4O and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[4-[1-(3,4-difluorophenyl)ethylamino]pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-[1-(3,4-difluorophenyl)ethylamino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 43695171 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[4-[1-(3,4-difluorophenyl)ethylamino]pyrazol-1-yl]acetamide |
| SMILES | CC(Nc1cnn(CC(N)=O)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H14F2N4O/c1-8(9-2-3-11(14)12(15)4-9)18-10-5-17-19(6-10)7-13(16)20/h2-6,8,18H,7H2,1H3,(H2,16,20) |
| InChIKey | BIFPKQLIEKSQJR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |