C15H19Cl2N3O — CID 110012191
1-(2,4-dichlorophenyl)-2-(4-pyrazol-1-ylbutan-2-ylamino)ethanol (PubChem CID 110012191) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(4-pyrazol-1-ylbutan-2-ylamino)ethanol.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(4-pyrazol-1-ylbutan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 110012191 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(4-pyrazol-1-ylbutan-2-ylamino)ethanol |
| SMILES | CC(CCn1cccn1)NCC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O/c1-11(5-8-20-7-2-6-19-20)18-10-15(21)13-4-3-12(16)9-14(13)17/h2-4,6-7,9,11,15,18,21H,5,8,10H2,1H3 |
| InChIKey | VDFSJUYTRUZNSJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |