C15H17Cl2N3O2 — CID 111970018
1-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3-(2-pyrrol-1-ylethyl)urea (PubChem CID 111970018) has the molecular formula C15H17Cl2N3O2 and a molecular weight of 342.23 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3-(2-pyrrol-1-ylethyl)urea.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3-(2-pyrrol-1-ylethyl)urea |
|---|---|
| PubChem CID | 111970018 |
| Molecular Formula | C15H17Cl2N3O2 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3-(2-pyrrol-1-ylethyl)urea |
| SMILES | O=C(NCCn1cccc1)NCC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl2N3O2/c16-11-3-4-12(13(17)9-11)14(21)10-19-15(22)18-5-8-20-6-1-2-7-20/h1-4,6-7,9,14,21H,5,8,10H2,(H2,18,19,22) |
| InChIKey | JQVIRZQJNNOZRO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |