C15H18FN3O2 — CID 111969990
1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(2-pyrrol-1-ylethyl)urea (PubChem CID 111969990) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(2-pyrrol-1-ylethyl)urea.
| Compound Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(2-pyrrol-1-ylethyl)urea |
|---|---|
| PubChem CID | 111969990 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(2-pyrrol-1-ylethyl)urea |
| SMILES | O=C(NCCn1cccc1)NCC(O)c1ccccc1F |
| InChI | InChI=1S/C15H18FN3O2/c16-13-6-2-1-5-12(13)14(20)11-18-15(21)17-7-10-19-8-3-4-9-19/h1-6,8-9,14,20H,7,10-11H2,(H2,17,18,21) |
| InChIKey | NZAJCJOGJBDQHV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |