C18H22N2O3 — CID 110012995
N-(4-hydroxy-2-phenylpentyl)-4-methyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 110012995) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-(4-hydroxy-2-phenylpentyl)-4-methyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(4-hydroxy-2-phenylpentyl)-4-methyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110012995 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-(4-hydroxy-2-phenylpentyl)-4-methyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc[nH]c(=O)c1C(=O)NCC(CC(C)O)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c1-12-8-9-19-17(22)16(12)18(23)20-11-15(10-13(2)21)14-6-4-3-5-7-14/h3-9,13,15,21H,10-11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | BOOMKYPZZDUXCM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |