C17H26O5 — CID 11001402
diethyl 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-hydroxypropanedioate (PubChem CID 11001402) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is diethyl 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-hydroxypropanedioate.
| Compound Name | diethyl 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-hydroxypropanedioate |
|---|---|
| PubChem CID | 11001402 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | diethyl 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-hydroxypropanedioate |
| SMILES | CCOC(=O)C(O)(CC1=CC[C@H]2C[C@@H]1C2(C)C)C(=O)OCC |
| InChI | InChI=1S/C17H26O5/c1-5-21-14(18)17(20,15(19)22-6-2)10-11-7-8-12-9-13(11)16(12,3)4/h7,12-13,20H,5-6,8-10H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | UOXXXLDDSPPPNL-STQMWFEESA-N |
| XLogP | 2.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|