C16H24O4 — CID 11808098
methyl (2R,3R,4S)-2-acetyl-3-hydroxy-1,1,7-trimethylspiro[3.5]non-7-ene-3-carboxylate (PubChem CID 11808098) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (2R,3R,4S)-2-acetyl-3-hydroxy-1,1,7-trimethylspiro[3.5]non-7-ene-3-carboxylate.
| Compound Name | methyl (2R,3R,4S)-2-acetyl-3-hydroxy-1,1,7-trimethylspiro[3.5]non-7-ene-3-carboxylate |
|---|---|
| PubChem CID | 11808098 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (2R,3R,4S)-2-acetyl-3-hydroxy-1,1,7-trimethylspiro[3.5]non-7-ene-3-carboxylate |
| SMILES | COC(=O)[C@@]1(O)[C@H](C(C)=O)C(C)(C)[C@]12CC=C(C)CC2 |
| InChI | InChI=1S/C16H24O4/c1-10-6-8-15(9-7-10)14(3,4)12(11(2)17)16(15,19)13(18)20-5/h6,12,19H,7-9H2,1-5H3/t12-,15-,16+/m1/s1 |
| InChIKey | AJGUMCZDXHZUHL-WQVCFCJDSA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|