C19H28O4 — CID 10936114
methyl 2-[(6S,8S,8aR)-8,8a-dimethyl-3-oxo-6-prop-1-en-2-yl-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate (PubChem CID 10936114) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is methyl 2-[(6S,8S,8aR)-8,8a-dimethyl-3-oxo-6-prop-1-en-2-yl-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate.
| Compound Name | methyl 2-[(6S,8S,8aR)-8,8a-dimethyl-3-oxo-6-prop-1-en-2-yl-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 10936114 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | methyl 2-[(6S,8S,8aR)-8,8a-dimethyl-3-oxo-6-prop-1-en-2-yl-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate |
| SMILES | C=C(C)[C@@H]1CC2=CC(=O)C(C(C)(O)C(=O)OC)C[C@]2(C)[C@@H](C)C1 |
| InChI | InChI=1S/C19H28O4/c1-11(2)13-7-12(3)18(4)10-15(16(20)9-14(18)8-13)19(5,22)17(21)23-6/h9,12-13,15,22H,1,7-8,10H2,2-6H3/t12-,13-,15?,18+,19?/m0/s1 |
| InChIKey | DAQQJVVVAVXVBM-VVDJSLJPSA-N |
| XLogP | 3.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|