C15H22O5 — CID 138966269
methyl (1R,2S,6S,8aR)-1-ethyl-2,6-dihydroxy-8a-methyl-3-oxo-5,6,7,8-tetrahydro-1H-naphthalene-2-carboxylate (PubChem CID 138966269) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl (1R,2S,6S,8aR)-1-ethyl-2,6-dihydroxy-8a-methyl-3-oxo-5,6,7,8-tetrahydro-1H-naphthalene-2-carboxylate.
| Compound Name | methyl (1R,2S,6S,8aR)-1-ethyl-2,6-dihydroxy-8a-methyl-3-oxo-5,6,7,8-tetrahydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 138966269 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | methyl (1R,2S,6S,8aR)-1-ethyl-2,6-dihydroxy-8a-methyl-3-oxo-5,6,7,8-tetrahydro-1H-naphthalene-2-carboxylate |
| SMILES | CC[C@H]1[C@@](O)(C(=O)OC)C(=O)C=C2C[C@@H](O)CC[C@@]21C |
| InChI | InChI=1S/C15H22O5/c1-4-11-14(2)6-5-10(16)7-9(14)8-12(17)15(11,19)13(18)20-3/h8,10-11,16,19H,4-7H2,1-3H3/t10-,11+,14-,15-/m0/s1 |
| InChIKey | PFQQOVJWFWHUFL-JLUCKKNBSA-N |
| XLogP | 0.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|