C18H24ClNO3 — CID 110014293
N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2-hydroxycyclopentane-1-carboxamide (PubChem CID 110014293) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2-hydroxycyclopentane-1-carboxamide.
| Compound Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110014293 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2-hydroxycyclopentane-1-carboxamide |
| SMILES | O=C(NCC1(c2ccc(Cl)cc2)CCOCC1)C1CCCC1O |
| InChI | InChI=1S/C18H24ClNO3/c19-14-6-4-13(5-7-14)18(8-10-23-11-9-18)12-20-17(22)15-2-1-3-16(15)21/h4-7,15-16,21H,1-3,8-12H2,(H,20,22) |
| InChIKey | PZICRCNFEKEWOU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |