C16H18ClNO2 — CID 176519551
N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]buta-2,3-dienamide (PubChem CID 176519551) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]buta-2,3-dienamide.
| Compound Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176519551 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NCC1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C16H18ClNO2/c1-2-3-15(19)18-12-16(8-10-20-11-9-16)13-4-6-14(17)7-5-13/h3-7H,1,8-12H2,(H,18,19) |
| InChIKey | TZAGICWUGJSHIK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|