C14H16F4N2O3 — CID 110017592
N'-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-N-(2,2,2-trifluoroethyl)propanediamide (PubChem CID 110017592) has the molecular formula C14H16F4N2O3 and a molecular weight of 336.29 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-N-(2,2,2-trifluoroethyl)propanediamide.
| Compound Name | N'-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-N-(2,2,2-trifluoroethyl)propanediamide |
|---|---|
| PubChem CID | 110017592 |
| Molecular Formula | C14H16F4N2O3 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N'-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-N-(2,2,2-trifluoroethyl)propanediamide |
| SMILES | CC(NC(=O)CC(=O)NCC(F)(F)F)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H16F4N2O3/c1-8(13(23)9-2-4-10(15)5-3-9)20-12(22)6-11(21)19-7-14(16,17)18/h2-5,8,13,23H,6-7H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | SKMUOMPWMPDDGO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|