About (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide
(2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide (PubChem CID 97237186) has the molecular formula C16H24FNO3
and a molecular weight of 297.37 g/mol. Its IUPAC name is (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide.
Molecular Properties
| Compound Name | (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide |
| PubChem CID | 97237186 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide |
| SMILES | CCCCO[C@H](C)C(=O)N[C@H](C)[C@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FNO3/c1-4-5-10-21-12(3)16(20)18-11(2)15(19)13-6-8-14(17)9-7-13/h6-9,11-12,15,19H,4-5,10H2,1-3H3,(H,18,20)/t11-,12-,15+/m1/s1 |
| InChIKey | KBEFCFSCJOYYLX-JMSVASOKSA-N |
| XLogP | 2.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide?
The IUPAC name of (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide (CID 97237186) is (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide.
What is the SMILES notation for (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide?
The canonical SMILES for (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide is CCCCO[C@H](C)C(=O)N[C@H](C)[C@H](O)c1ccc(F)cc1.
What is the InChIKey of (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide?
The InChIKey is KBEFCFSCJOYYLX-JMSVASOKSA-N. The full InChI is InChI=1S/C16H24FNO3/c1-4-5-10-21-12(3)16(20)18-11(2)15(19)13-6-8-14(17)9-7-13/h6-9,11-12,15,19H,4-5,10H2,1-3H3,(H,18,20)/t11-,12-,15+/m1/s1.
What are the key properties of (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide?
(2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide has a molecular weight of 297.37 g/mol, XLogP of 2.57, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-butoxy-N-[(1R,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]propanamide is sourced from PubChem (CID 97237186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).