C22H29NO4 — CID 48658410
N-[bis(4-methoxyphenyl)methyl]-2-butoxypropanamide (PubChem CID 48658410) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[bis(4-methoxyphenyl)methyl]-2-butoxypropanamide.
| Compound Name | N-[bis(4-methoxyphenyl)methyl]-2-butoxypropanamide |
|---|---|
| PubChem CID | 48658410 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-[bis(4-methoxyphenyl)methyl]-2-butoxypropanamide |
| SMILES | CCCCOC(C)C(=O)NC(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29NO4/c1-5-6-15-27-16(2)22(24)23-21(17-7-11-19(25-3)12-8-17)18-9-13-20(26-4)14-10-18/h7-14,16,21H,5-6,15H2,1-4H3,(H,23,24) |
| InChIKey | NKAVICXWLMPZOM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|