C21H24N4O4 — CID 110021238
1-[1-(1-benzofuran-2-yl)ethyl]-3-(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine (PubChem CID 110021238) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110021238 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine |
| SMILES | COCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NC(C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H24N4O4/c1-15(20-13-17-5-3-4-6-19(17)29-20)24-21(22-11-12-28-2)23-14-16-7-9-18(10-8-16)25(26)27/h3-10,13,15H,11-12,14H2,1-2H3,(H2,22,23,24) |
| InChIKey | VJSRWJLGOCPYHK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|