C17H19FN2O2 — CID 110026076
N'-(2-fluoro-5-methylphenyl)-3-hydroxy-3-phenylbutanehydrazide (PubChem CID 110026076) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is N'-(2-fluoro-5-methylphenyl)-3-hydroxy-3-phenylbutanehydrazide.
| Compound Name | N'-(2-fluoro-5-methylphenyl)-3-hydroxy-3-phenylbutanehydrazide |
|---|---|
| PubChem CID | 110026076 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N'-(2-fluoro-5-methylphenyl)-3-hydroxy-3-phenylbutanehydrazide |
| SMILES | Cc1ccc(F)c(NNC(=O)CC(C)(O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H19FN2O2/c1-12-8-9-14(18)15(10-12)19-20-16(21)11-17(2,22)13-6-4-3-5-7-13/h3-10,19,22H,11H2,1-2H3,(H,20,21) |
| InChIKey | RBOWXFZGDJDQCY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|