C18H26N2O3 — CID 110026464
4-[[(Z)-2,3-dimethylpent-2-enoyl]amino]-N-(1-hydroxybutan-2-yl)benzamide (PubChem CID 110026464) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[[(Z)-2,3-dimethylpent-2-enoyl]amino]-N-(1-hydroxybutan-2-yl)benzamide.
| Compound Name | 4-[[(Z)-2,3-dimethylpent-2-enoyl]amino]-N-(1-hydroxybutan-2-yl)benzamide |
|---|---|
| PubChem CID | 110026464 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 4-[[(Z)-2,3-dimethylpent-2-enoyl]amino]-N-(1-hydroxybutan-2-yl)benzamide |
| SMILES | CC/C(C)=C(/C)C(=O)Nc1ccc(C(=O)NC(CC)CO)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-5-12(3)13(4)17(22)20-16-9-7-14(8-10-16)18(23)19-15(6-2)11-21/h7-10,15,21H,5-6,11H2,1-4H3,(H,19,23)(H,20,22)/b13-12- |
| InChIKey | IIJGFKHWXJWMIP-SEYXRHQNSA-N |
| XLogP | 2.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|