C18H28N2O3 — CID 110026465
4-(2,3-dimethylpentanoylamino)-N-(1-hydroxybutan-2-yl)benzamide (PubChem CID 110026465) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 4-(2,3-dimethylpentanoylamino)-N-(1-hydroxybutan-2-yl)benzamide.
| Compound Name | 4-(2,3-dimethylpentanoylamino)-N-(1-hydroxybutan-2-yl)benzamide |
|---|---|
| PubChem CID | 110026465 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 4-(2,3-dimethylpentanoylamino)-N-(1-hydroxybutan-2-yl)benzamide |
| SMILES | CCC(CO)NC(=O)c1ccc(NC(=O)C(C)C(C)CC)cc1 |
| InChI | InChI=1S/C18H28N2O3/c1-5-12(3)13(4)17(22)20-16-9-7-14(8-10-16)18(23)19-15(6-2)11-21/h7-10,12-13,15,21H,5-6,11H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | WFAFHTGMRQYUFL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |