C21H29N5O2 — CID 110026821
2-[(3,4-dimethoxyphenyl)methyl]-1-[(6-methyl-2-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine (PubChem CID 110026821) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[(6-methyl-2-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(6-methyl-2-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 110026821 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(6-methyl-2-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCc2ccc(C)nc2N2CCCC2)cc1OC |
| InChI | InChI=1S/C21H29N5O2/c1-15-6-8-17(20(25-15)26-10-4-5-11-26)14-24-21(22)23-13-16-7-9-18(27-2)19(12-16)28-3/h6-9,12H,4-5,10-11,13-14H2,1-3H3,(H3,22,23,24) |
| InChIKey | VQQUYCDBKPEHSP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|