C12H16F3NOS — CID 110027624
2-[methyl-[[3-(trifluoromethylsulfanyl)phenyl]methyl]amino]propan-1-ol (PubChem CID 110027624) has the molecular formula C12H16F3NOS and a molecular weight of 279.33 g/mol. Its IUPAC name is 2-[methyl-[[3-(trifluoromethylsulfanyl)phenyl]methyl]amino]propan-1-ol.
| Compound Name | 2-[methyl-[[3-(trifluoromethylsulfanyl)phenyl]methyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 110027624 |
| Molecular Formula | C12H16F3NOS |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[methyl-[[3-(trifluoromethylsulfanyl)phenyl]methyl]amino]propan-1-ol |
| SMILES | CC(CO)N(C)Cc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NOS/c1-9(8-17)16(2)7-10-4-3-5-11(6-10)18-12(13,14)15/h3-6,9,17H,7-8H2,1-2H3 |
| InChIKey | NBJXNUDRAGAKMP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |