C13H12F4O2S — CID 66982684
ethyl (E)-2-fluoro-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoate (PubChem CID 66982684) has the molecular formula C13H12F4O2S and a molecular weight of 308.30 g/mol. Its IUPAC name is ethyl (E)-2-fluoro-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoate.
| Compound Name | ethyl (E)-2-fluoro-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 66982684 |
| Molecular Formula | C13H12F4O2S |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | ethyl (E)-2-fluoro-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoate |
| SMILES | CCOC(=O)/C(F)=C\Cc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F4O2S/c1-2-19-12(18)11(14)7-6-9-4-3-5-10(8-9)20-13(15,16)17/h3-5,7-8H,2,6H2,1H3/b11-7+ |
| InChIKey | UHIBFCHAAUQKFV-YRNVUSSQSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|