C15H16F3NO4S — CID 57261281
ethyl 3-[[3-(trifluoromethylsulfanyl)phenyl]methoxycarbonylimino]butanoate (PubChem CID 57261281) has the molecular formula C15H16F3NO4S and a molecular weight of 363.36 g/mol. Its IUPAC name is ethyl 3-[[3-(trifluoromethylsulfanyl)phenyl]methoxycarbonylimino]butanoate.
| Compound Name | ethyl 3-[[3-(trifluoromethylsulfanyl)phenyl]methoxycarbonylimino]butanoate |
|---|---|
| PubChem CID | 57261281 |
| Molecular Formula | C15H16F3NO4S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | ethyl 3-[[3-(trifluoromethylsulfanyl)phenyl]methoxycarbonylimino]butanoate |
| SMILES | CCOC(=O)CC(C)=NC(=O)OCc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3NO4S/c1-3-22-13(20)7-10(2)19-14(21)23-9-11-5-4-6-12(8-11)24-15(16,17)18/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | ALCWGSNCZMHJLN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|