C18H28F3NS — CID 145394691
ethane;4-ethyl-4-methyl-1-[[3-(trifluoromethylsulfanyl)phenyl]methyl]piperidine (PubChem CID 145394691) has the molecular formula C18H28F3NS and a molecular weight of 347.49 g/mol. Its IUPAC name is ethane;4-ethyl-4-methyl-1-[[3-(trifluoromethylsulfanyl)phenyl]methyl]piperidine.
| Compound Name | ethane;4-ethyl-4-methyl-1-[[3-(trifluoromethylsulfanyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 145394691 |
| Molecular Formula | C18H28F3NS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | ethane;4-ethyl-4-methyl-1-[[3-(trifluoromethylsulfanyl)phenyl]methyl]piperidine |
| SMILES | CC.CCC1(C)CCN(Cc2cccc(SC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H22F3NS.C2H6/c1-3-15(2)7-9-20(10-8-15)12-13-5-4-6-14(11-13)21-16(17,18)19;1-2/h4-6,11H,3,7-10,12H2,1-2H3;1-2H3 |
| InChIKey | SZRWOQBMSFCVNG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |