C17H25ClN2O2 — CID 110027638
2-chloro-N-[3-(4-hydroxypiperidin-1-yl)propyl]-4,5-dimethylbenzamide (PubChem CID 110027638) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-hydroxypiperidin-1-yl)propyl]-4,5-dimethylbenzamide.
| Compound Name | 2-chloro-N-[3-(4-hydroxypiperidin-1-yl)propyl]-4,5-dimethylbenzamide |
|---|---|
| PubChem CID | 110027638 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-chloro-N-[3-(4-hydroxypiperidin-1-yl)propyl]-4,5-dimethylbenzamide |
| SMILES | Cc1cc(Cl)c(C(=O)NCCCN2CCC(O)CC2)cc1C |
| InChI | InChI=1S/C17H25ClN2O2/c1-12-10-15(16(18)11-13(12)2)17(22)19-6-3-7-20-8-4-14(21)5-9-20/h10-11,14,21H,3-9H2,1-2H3,(H,19,22) |
| InChIKey | BZLZAKMCRUEXGK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|