C25H27IN4O2 — CID 110029061
1-[(4-methylphenyl)methyl]-2-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]-3-phenylguanidine;hydroiodide (PubChem CID 110029061) has the molecular formula C25H27IN4O2 and a molecular weight of 542.42 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-2-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]-3-phenylguanidine;hydroiodide.
| Compound Name | 1-[(4-methylphenyl)methyl]-2-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]-3-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110029061 |
| Molecular Formula | C25H27IN4O2 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-2-[[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]-3-phenylguanidine;hydroiodide |
| SMILES | Cc1ccc(CN/C(=N\Cc2ccc(N3CCOC3=O)cc2)Nc2ccccc2)cc1.I |
| InChI | InChI=1S/C25H26N4O2.HI/c1-19-7-9-20(10-8-19)17-26-24(28-22-5-3-2-4-6-22)27-18-21-11-13-23(14-12-21)29-15-16-31-25(29)30;/h2-14H,15-18H2,1H3,(H2,26,27,28);1H |
| InChIKey | FSRJZJURIKPXLY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|