C17H19BrO2S — CID 11003088
(1R,2S,3R)-2-bromo-3-methyl-1-phenyl-4-[(S)-phenylsulfinyl]butan-1-ol (PubChem CID 11003088) has the molecular formula C17H19BrO2S and a molecular weight of 367.31 g/mol. Its IUPAC name is (1R,2S,3R)-2-bromo-3-methyl-1-phenyl-4-[(S)-phenylsulfinyl]butan-1-ol.
| Compound Name | (1R,2S,3R)-2-bromo-3-methyl-1-phenyl-4-[(S)-phenylsulfinyl]butan-1-ol |
|---|---|
| PubChem CID | 11003088 |
| Molecular Formula | C17H19BrO2S |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (1R,2S,3R)-2-bromo-3-methyl-1-phenyl-4-[(S)-phenylsulfinyl]butan-1-ol |
| SMILES | C[C@H](C[S@](=O)c1ccccc1)[C@H](Br)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H19BrO2S/c1-13(12-21(20)15-10-6-3-7-11-15)16(18)17(19)14-8-4-2-5-9-14/h2-11,13,16-17,19H,12H2,1H3/t13-,16+,17-,21+/m1/s1 |
| InChIKey | BIQBNWUCBAIPBD-YFPSAGDSSA-N |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|