C17H24FN5O — CID 110032010
2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-1-(3-methylbutyl)guanidine (PubChem CID 110032010) has the molecular formula C17H24FN5O and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-1-(3-methylbutyl)guanidine.
| Compound Name | 2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-1-(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 110032010 |
| Molecular Formula | C17H24FN5O |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-1-(3-methylbutyl)guanidine |
| SMILES | CC(C)CCN/C(N)=N/CCCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H24FN5O/c1-12(2)9-11-21-17(19)20-10-3-4-15-22-16(23-24-15)13-5-7-14(18)8-6-13/h5-8,12H,3-4,9-11H2,1-2H3,(H3,19,20,21) |
| InChIKey | RBKWITUTDGTUAQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|