C23H38IN5O2S — CID 110036806
2-[[(2-bicyclo[2.2.1]heptanylamino)-[[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110036806) has the molecular formula C23H38IN5O2S and a molecular weight of 575.56 g/mol. Its IUPAC name is 2-[[(2-bicyclo[2.2.1]heptanylamino)-[[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(2-bicyclo[2.2.1]heptanylamino)-[[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110036806 |
| Molecular Formula | C23H38IN5O2S |
| Molecular Weight | 575.56 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 2-[[(2-bicyclo[2.2.1]heptanylamino)-[[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC1CN(C(CN/C(=N\CC(=O)N(C)C)NC2CC3CCC2C3)c2cccs2)CCO1.I |
| InChI | InChI=1S/C23H37N5O2S.HI/c1-16-15-28(8-9-30-16)20(21-5-4-10-31-21)13-24-23(25-14-22(29)27(2)3)26-19-12-17-6-7-18(19)11-17;/h4-5,10,16-20H,6-9,11-15H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | CYGNYPQHVPCXQX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|