C20H31FIN5O — CID 110037414
2-[[(cyclopentylamino)-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110037414) has the molecular formula C20H31FIN5O and a molecular weight of 503.40 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclopentylamino)-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110037414 |
| Molecular Formula | C20H31FIN5O |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2-[[(cyclopentylamino)-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCCC1)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C20H30FN5O.HI/c1-24(2)19(27)15-22-20(23-17-5-3-4-6-17)26-13-11-25(12-14-26)18-9-7-16(21)8-10-18;/h7-10,17H,3-6,11-15H2,1-2H3,(H,22,23);1H |
| InChIKey | LDSAZSYZWTXKTM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|