C19H17Cl2NO2S — CID 11003753
2-chloro-4-(4-chlorophenyl)-5-[3-(2-methylsulfanylphenoxy)propyl]-1,3-oxazole (PubChem CID 11003753) has the molecular formula C19H17Cl2NO2S and a molecular weight of 394.32 g/mol. Its IUPAC name is 2-chloro-4-(4-chlorophenyl)-5-[3-(2-methylsulfanylphenoxy)propyl]-1,3-oxazole.
| Compound Name | 2-chloro-4-(4-chlorophenyl)-5-[3-(2-methylsulfanylphenoxy)propyl]-1,3-oxazole |
|---|---|
| PubChem CID | 11003753 |
| Molecular Formula | C19H17Cl2NO2S |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-chloro-4-(4-chlorophenyl)-5-[3-(2-methylsulfanylphenoxy)propyl]-1,3-oxazole |
| SMILES | CSc1ccccc1OCCCc1oc(Cl)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2NO2S/c1-25-17-7-3-2-5-15(17)23-12-4-6-16-18(22-19(21)24-16)13-8-10-14(20)11-9-13/h2-3,5,7-11H,4,6,12H2,1H3 |
| InChIKey | CLTYLZHJBDCTMW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|