C16H17Cl2NO3 — CID 11099941
ethyl 5-[2-chloro-4-(4-chlorophenyl)-1,3-oxazol-5-yl]pentanoate (PubChem CID 11099941) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is ethyl 5-[2-chloro-4-(4-chlorophenyl)-1,3-oxazol-5-yl]pentanoate.
| Compound Name | ethyl 5-[2-chloro-4-(4-chlorophenyl)-1,3-oxazol-5-yl]pentanoate |
|---|---|
| PubChem CID | 11099941 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | ethyl 5-[2-chloro-4-(4-chlorophenyl)-1,3-oxazol-5-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1oc(Cl)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2NO3/c1-2-21-14(20)6-4-3-5-13-15(19-16(18)22-13)11-7-9-12(17)10-8-11/h7-10H,2-6H2,1H3 |
| InChIKey | RKFXSIJTTAACDY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|