C16H18ClNO4 — CID 11012751
ethyl 5-[4-(4-chlorophenyl)-2-oxo-3H-1,3-oxazol-5-yl]pentanoate (PubChem CID 11012751) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is ethyl 5-[4-(4-chlorophenyl)-2-oxo-3H-1,3-oxazol-5-yl]pentanoate.
| Compound Name | ethyl 5-[4-(4-chlorophenyl)-2-oxo-3H-1,3-oxazol-5-yl]pentanoate |
|---|---|
| PubChem CID | 11012751 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | ethyl 5-[4-(4-chlorophenyl)-2-oxo-3H-1,3-oxazol-5-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1oc(=O)[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClNO4/c1-2-21-14(19)6-4-3-5-13-15(18-16(20)22-13)11-7-9-12(17)10-8-11/h7-10H,2-6H2,1H3,(H,18,20) |
| InChIKey | JZABEATWZYOWJZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|