C17H27ClN4O — CID 110037725
2-[[(butan-2-ylamino)-[(2-chlorophenyl)methyl-methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110037725) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is 2-[[(butan-2-ylamino)-[(2-chlorophenyl)methyl-methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(butan-2-ylamino)-[(2-chlorophenyl)methyl-methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110037725 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-[[(butan-2-ylamino)-[(2-chlorophenyl)methyl-methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C17H27ClN4O/c1-6-13(2)20-17(19-11-16(23)21(3)4)22(5)12-14-9-7-8-10-15(14)18/h7-10,13H,6,11-12H2,1-5H3,(H,19,20) |
| InChIKey | DMMISYLVFJPTMI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|