C18H29FN4O2 — CID 110038523
2-[[(butan-2-ylamino)-[2-(2-fluorophenoxy)ethyl-methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110038523) has the molecular formula C18H29FN4O2 and a molecular weight of 352.45 g/mol. Its IUPAC name is 2-[[(butan-2-ylamino)-[2-(2-fluorophenoxy)ethyl-methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(butan-2-ylamino)-[2-(2-fluorophenoxy)ethyl-methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110038523 |
| Molecular Formula | C18H29FN4O2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-[[(butan-2-ylamino)-[2-(2-fluorophenoxy)ethyl-methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C18H29FN4O2/c1-6-14(2)21-18(20-13-17(24)22(3)4)23(5)11-12-25-16-10-8-7-9-15(16)19/h7-10,14H,6,11-13H2,1-5H3,(H,20,21) |
| InChIKey | HAUPGGMMGIWOAJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|