C22H42N6O3 — CID 110039601
2-[[[[1-(2-ethylbutanoyl)piperidin-4-yl]amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110039601) has the molecular formula C22H42N6O3 and a molecular weight of 438.62 g/mol. Its IUPAC name is 2-[[[[1-(2-ethylbutanoyl)piperidin-4-yl]amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(2-ethylbutanoyl)piperidin-4-yl]amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110039601 |
| Molecular Formula | C22H42N6O3 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | 2-[[[[1-(2-ethylbutanoyl)piperidin-4-yl]amino]-(2-morpholin-4-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC(CC)C(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C22H42N6O3/c1-5-18(6-2)21(30)28-10-7-19(8-11-28)25-22(24-17-20(29)26(3)4)23-9-12-27-13-15-31-16-14-27/h18-19H,5-17H2,1-4H3,(H2,23,24,25) |
| InChIKey | WEJYHCQLGMJWNR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|