C22H42O5Si — CID 11004227
tert-butyl-[(E)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(oxan-2-yloxy)hex-5-enoxy]-dimethylsilane (PubChem CID 11004227) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is tert-butyl-[(E)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(oxan-2-yloxy)hex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(oxan-2-yloxy)hex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11004227 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | tert-butyl-[(E)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(oxan-2-yloxy)hex-5-enoxy]-dimethylsilane |
| SMILES | CC1(C)OCC(/C=C/C(CCCO[Si](C)(C)C(C)(C)C)OC2CCCCO2)O1 |
| InChI | InChI=1S/C22H42O5Si/c1-21(2,3)28(6,7)25-16-10-11-18(26-20-12-8-9-15-23-20)13-14-19-17-24-22(4,5)27-19/h13-14,18-20H,8-12,15-17H2,1-7H3/b14-13+ |
| InChIKey | VHZXOSQOOVIDHT-BUHFOSPRSA-N |
| XLogP | 5.41 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|