C27H29NO3 — CID 11004236
methyl (2S,4R)-4-methyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 11004236) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is methyl (2S,4R)-4-methyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | methyl (2S,4R)-4-methyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11004236 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | methyl (2S,4R)-4-methyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1C[C@H](C)C[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO3/c1-21-18-25(28(19-21)26(29)30-2)20-31-27(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,21,25H,18-20H2,1-2H3/t21-,25+/m1/s1 |
| InChIKey | LOBWDWSCZJHACW-BWKNWUBXSA-N |
| XLogP | 5.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|