C21H32N4O3 — CID 110042450
2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[3-(ethoxymethyl)pyrrolidin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110042450) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[3-(ethoxymethyl)pyrrolidin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[3-(ethoxymethyl)pyrrolidin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110042450 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[3-(ethoxymethyl)pyrrolidin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCOCC1CCN(/C(=N\CC(=O)N(C)C)NC2CCOc3ccccc32)C1 |
| InChI | InChI=1S/C21H32N4O3/c1-4-27-15-16-9-11-25(14-16)21(22-13-20(26)24(2)3)23-18-10-12-28-19-8-6-5-7-17(18)19/h5-8,16,18H,4,9-15H2,1-3H3,(H,22,23) |
| InChIKey | MFAPYGLDNXWLEA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|