C22H32N4O2 — CID 110041344
2-[[2-azaspiro[4.4]nonan-2-yl-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110041344) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[[2-azaspiro[4.4]nonan-2-yl-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[2-azaspiro[4.4]nonan-2-yl-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110041344 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-[[2-azaspiro[4.4]nonan-2-yl-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCOc2ccccc21)N1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C22H32N4O2/c1-25(2)20(27)15-23-21(26-13-12-22(16-26)10-5-6-11-22)24-18-9-14-28-19-8-4-3-7-17(18)19/h3-4,7-8,18H,5-6,9-16H2,1-2H3,(H,23,24) |
| InChIKey | UAWASIZMVQLZLY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|