C18H31N7O2 — CID 110043511
N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[4-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methylidene]amino]acetamide (PubChem CID 110043511) has the molecular formula C18H31N7O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[4-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[4-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110043511 |
| Molecular Formula | C18H31N7O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[4-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCO1)N1CCC(c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C18H31N7O2/c1-24(2)16(26)12-20-18(19-11-15-5-3-4-10-27-15)25-8-6-14(7-9-25)17-21-13-22-23-17/h13-15H,3-12H2,1-2H3,(H,19,20)(H,21,22,23) |
| InChIKey | YVVLXLZNKHVCLS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|