C16H30N4O4S — CID 110046395
2-[[(2,2-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl)-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110046395) has the molecular formula C16H30N4O4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[[(2,2-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl)-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2,2-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl)-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110046395 |
| Molecular Formula | C16H30N4O4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[[(2,2-dimethyl-1,1-dioxo-1,4-thiazinan-4-yl)-(oxolan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCOC1)N1CCS(=O)(=O)C(C)(C)C1 |
| InChI | InChI=1S/C16H30N4O4S/c1-16(2)12-20(6-8-25(16,22)23)15(18-10-14(21)19(3)4)17-9-13-5-7-24-11-13/h13H,5-12H2,1-4H3,(H,17,18) |
| InChIKey | DEFVSJQTLHFCFN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|