C19H34N4O4 — CID 110050122
N,N-dimethyl-2-[[[3-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-(oxolan-3-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110050122) has the molecular formula C19H34N4O4 and a molecular weight of 382.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-(oxolan-3-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[3-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-(oxolan-3-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110050122 |
| Molecular Formula | C19H34N4O4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(2-methyl-1,3-dioxolan-2-yl)piperidin-1-yl]-(oxolan-3-ylmethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCOC1)N1CCCC(C2(C)OCCO2)C1 |
| InChI | InChI=1S/C19H34N4O4/c1-19(26-9-10-27-19)16-5-4-7-23(13-16)18(21-12-17(24)22(2)3)20-11-15-6-8-25-14-15/h15-16H,4-14H2,1-3H3,(H,20,21) |
| InChIKey | GEFBRMJHVFJWHL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|